C17H28BFO2 — CID 175746466
2-[3-fluoro-5-methyl-6-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 175746466) has the molecular formula C17H28BFO2 and a molecular weight of 294.22 g/mol. Its IUPAC name is 2-[3-fluoro-5-methyl-6-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-fluoro-5-methyl-6-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175746466 |
| Molecular Formula | C17H28BFO2 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[3-fluoro-5-methyl-6-(2-methylpropyl)cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)CC1C(B2OC(C)(C)C(C)(C)O2)=CC(F)=CC1C |
| InChI | InChI=1S/C17H28BFO2/c1-11(2)8-14-12(3)9-13(19)10-15(14)18-20-16(4,5)17(6,7)21-18/h9-12,14H,8H2,1-7H3 |
| InChIKey | BTKHYMJKXKETCE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|