About tricalcium;1,3-benzothiazole;diphosphate
tricalcium;1,3-benzothiazole;diphosphate (PubChem CID 175746475) has the molecular formula C7H5Ca3NO8P2S
and a molecular weight of 445.37 g/mol. Its IUPAC name is tricalcium;1,3-benzothiazole;diphosphate.
Molecular Properties
| Compound Name | tricalcium;1,3-benzothiazole;diphosphate |
| PubChem CID | 175746475 |
| Molecular Formula | C7H5Ca3NO8P2S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.81 |
| IUPAC Name | tricalcium;1,3-benzothiazole;diphosphate |
| SMILES | O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca+2].[Ca+2].[Ca+2].c1ccc2scnc2c1 |
| InChI | InChI=1S/C7H5NS.3Ca.2H3O4P/c1-2-4-7-6(3-1)8-5-9-7;;;;2*1-5(2,3)4/h1-5H;;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6 |
| InChIKey | BMQAUIVNLXHFLQ-UHFFFAOYSA-H |
| XLogP | -4.50 |
| TPSA | 185.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tricalcium;1,3-benzothiazole;diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricalcium;1,3-benzothiazole;diphosphate?
The IUPAC name of tricalcium;1,3-benzothiazole;diphosphate (CID 175746475) is tricalcium;1,3-benzothiazole;diphosphate.
What is the SMILES notation for tricalcium;1,3-benzothiazole;diphosphate?
The canonical SMILES for tricalcium;1,3-benzothiazole;diphosphate is O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Ca+2].[Ca+2].[Ca+2].c1ccc2scnc2c1.
What is the InChIKey of tricalcium;1,3-benzothiazole;diphosphate?
The InChIKey is BMQAUIVNLXHFLQ-UHFFFAOYSA-H. The full InChI is InChI=1S/C7H5NS.3Ca.2H3O4P/c1-2-4-7-6(3-1)8-5-9-7;;;;2*1-5(2,3)4/h1-5H;;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6.
What are the key properties of tricalcium;1,3-benzothiazole;diphosphate?
tricalcium;1,3-benzothiazole;diphosphate has a molecular weight of 445.37 g/mol, XLogP of -4.50, 0 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for tricalcium;1,3-benzothiazole;diphosphate is sourced from PubChem (CID 175746475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).