About 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole
5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole (PubChem CID 175748514) has the molecular formula C9H10FNS
and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole.
Molecular Properties
| Compound Name | 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole |
| PubChem CID | 175748514 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole |
| SMILES | Cc1c(F)ccc2c1CN(C)S2 |
| InChI | InChI=1S/C9H10FNS/c1-6-7-5-11(2)12-9(7)4-3-8(6)10/h3-4H,5H2,1-2H3 |
| InChIKey | XGRNJNSLOZNEST-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole?
The IUPAC name of 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole (CID 175748514) is 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole.
What is the SMILES notation for 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole?
The canonical SMILES for 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole is Cc1c(F)ccc2c1CN(C)S2.
What is the InChIKey of 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole?
The InChIKey is XGRNJNSLOZNEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNS/c1-6-7-5-11(2)12-9(7)4-3-8(6)10/h3-4H,5H2,1-2H3.
What are the key properties of 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole?
5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole has a molecular weight of 183.25 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4-dimethyl-3H-1,2-benzothiazole is sourced from PubChem (CID 175748514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).