C33H66F6N2O4S2 — CID 175748915
bis(trifluoromethylsulfonyl)azanide;tris-decyl(methyl)azanium (PubChem CID 175748915) has the molecular formula C33H66F6N2O4S2 and a molecular weight of 733.02 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;tris-decyl(methyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;tris-decyl(methyl)azanium |
|---|---|
| PubChem CID | 175748915 |
| Molecular Formula | C33H66F6N2O4S2 |
| Molecular Weight | 733.02 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;tris-decyl(methyl)azanium |
| SMILES | CCCCCCCCCC[N+](C)(CCCCCCCCCC)CCCCCCCCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H66N.C2F6NO4S2/c1-5-8-11-14-17-20-23-26-29-32(4,30-27-24-21-18-15-12-9-6-2)31-28-25-22-19-16-13-10-7-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-31H2,1-4H3;/q+1;-1 |
| InChIKey | QWHBNNSKJOCZGB-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.02 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|