C17H27N5O6S2 — CID 175749118
2-[4-[(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidin-1-yl]ethane-1,1-disulfonic acid (PubChem CID 175749118) has the molecular formula C17H27N5O6S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[4-[(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidin-1-yl]ethane-1,1-disulfonic acid.
| Compound Name | 2-[4-[(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidin-1-yl]ethane-1,1-disulfonic acid |
|---|---|
| PubChem CID | 175749118 |
| Molecular Formula | C17H27N5O6S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-[4-[(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidin-1-yl]ethane-1,1-disulfonic acid |
| SMILES | Cc1cc(NC2CCN(CC(S(=O)(=O)O)S(=O)(=O)O)CC2)n2ncc(C(C)C)c2n1 |
| InChI | InChI=1S/C17H27N5O6S2/c1-11(2)14-9-18-22-15(8-12(3)19-17(14)22)20-13-4-6-21(7-5-13)10-16(29(23,24)25)30(26,27)28/h8-9,11,13,16,20H,4-7,10H2,1-3H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | BHJXPJXSMXBQEQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|