C22H28O10 — CID 175749351
methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-tris(methoxymethyl)benzoate (PubChem CID 175749351) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-tris(methoxymethyl)benzoate.
| Compound Name | methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-tris(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 175749351 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | methyl 3,4,5-trihydroxybenzoate;methyl 3,4,5-tris(methoxymethyl)benzoate |
| SMILES | COC(=O)c1cc(O)c(O)c(O)c1.COCc1cc(C(=O)OC)cc(COC)c1COC |
| InChI | InChI=1S/C14H20O5.C8H8O5/c1-16-7-11-5-10(14(15)19-4)6-12(8-17-2)13(11)9-18-3;1-13-8(12)4-2-5(9)7(11)6(10)3-4/h5-6H,7-9H2,1-4H3;2-3,9-11H,1H3 |
| InChIKey | VBEGBCPYQUPTQF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|