C11H17F4N5 — CID 175749545
6-cyclohexyl-2-N-fluoro-5-(trifluoromethyl)-1H-pyrimidine-2,4,4-triamine (PubChem CID 175749545) has the molecular formula C11H17F4N5 and a molecular weight of 295.28 g/mol. Its IUPAC name is 6-cyclohexyl-2-N-fluoro-5-(trifluoromethyl)-1H-pyrimidine-2,4,4-triamine.
| Compound Name | 6-cyclohexyl-2-N-fluoro-5-(trifluoromethyl)-1H-pyrimidine-2,4,4-triamine |
|---|---|
| PubChem CID | 175749545 |
| Molecular Formula | C11H17F4N5 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 6-cyclohexyl-2-N-fluoro-5-(trifluoromethyl)-1H-pyrimidine-2,4,4-triamine |
| SMILES | NC1(N)N=C(NF)NC(C2CCCCC2)=C1C(F)(F)F |
| InChI | InChI=1S/C11H17F4N5/c12-10(13,14)8-7(6-4-2-1-3-5-6)18-9(20-15)19-11(8,16)17/h6H,1-5,16-17H2,(H2,18,19,20) |
| InChIKey | LRIFBDVGFPWMOK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|