C11H21N5 — CID 175749741
4-N,4-N,6-N,6-N-tetraethyltriazine-4,6-diamine (PubChem CID 175749741) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-N,4-N,6-N,6-N-tetraethyltriazine-4,6-diamine.
| Compound Name | 4-N,4-N,6-N,6-N-tetraethyltriazine-4,6-diamine |
|---|---|
| PubChem CID | 175749741 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 4-N,4-N,6-N,6-N-tetraethyltriazine-4,6-diamine |
| SMILES | CCN(CC)c1cc(N(CC)CC)nnn1 |
| InChI | InChI=1S/C11H21N5/c1-5-15(6-2)10-9-11(13-14-12-10)16(7-3)8-4/h9H,5-8H2,1-4H3 |
| InChIKey | GKOOSWPJLYJTOH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |