About [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate
[3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate (PubChem CID 175749835) has the molecular formula C15H13ClF3NO3S
and a molecular weight of 379.79 g/mol. Its IUPAC name is [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate |
| PubChem CID | 175749835 |
| Molecular Formula | C15H13ClF3NO3S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(-c2cccc(Cl)n2)c(C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13ClF3NO3S/c1-8-7-9(2)14(23-24(21,22)15(17,18)19)10(3)13(8)11-5-4-6-12(16)20-11/h4-7H,1-3H3 |
| InChIKey | AYGHPIKGHRLWNB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate?
The IUPAC name of [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate (CID 175749835) is [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate.
What is the SMILES notation for [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate?
The canonical SMILES for [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate is Cc1cc(C)c(-c2cccc(Cl)n2)c(C)c1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate?
The InChIKey is AYGHPIKGHRLWNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClF3NO3S/c1-8-7-9(2)14(23-24(21,22)15(17,18)19)10(3)13(8)11-5-4-6-12(16)20-11/h4-7H,1-3H3.
What are the key properties of [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate?
[3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate has a molecular weight of 379.79 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-chloro-2-pyridinyl)-2,4,6-trimethylphenyl] trifluoromethanesulfonate is sourced from PubChem (CID 175749835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).