About (113C)prop-2-enyl 2-oxopropanoate
(113C)prop-2-enyl 2-oxopropanoate (PubChem CID 175750558) has the molecular formula C6H8O3
and a molecular weight of 129.12 g/mol. Its IUPAC name is (113C)prop-2-enyl 2-oxopropanoate.
Molecular Properties
| Compound Name | (113C)prop-2-enyl 2-oxopropanoate |
| PubChem CID | 175750558 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | (113C)prop-2-enyl 2-oxopropanoate |
| SMILES | C=C[13CH2]OC(=O)C(C)=O |
| InChI | InChI=1S/C6H8O3/c1-3-4-9-6(8)5(2)7/h3H,1,4H2,2H3/i4+1 |
| InChIKey | NDWDHIIYLRBODW-AZXPZELESA-N |
| XLogP | 0.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (113C)prop-2-enyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (113C)prop-2-enyl 2-oxopropanoate?
The IUPAC name of (113C)prop-2-enyl 2-oxopropanoate (CID 175750558) is (113C)prop-2-enyl 2-oxopropanoate.
What is the SMILES notation for (113C)prop-2-enyl 2-oxopropanoate?
The canonical SMILES for (113C)prop-2-enyl 2-oxopropanoate is C=C[13CH2]OC(=O)C(C)=O.
What is the InChIKey of (113C)prop-2-enyl 2-oxopropanoate?
The InChIKey is NDWDHIIYLRBODW-AZXPZELESA-N. The full InChI is InChI=1S/C6H8O3/c1-3-4-9-6(8)5(2)7/h3H,1,4H2,2H3/i4+1.
What are the key properties of (113C)prop-2-enyl 2-oxopropanoate?
(113C)prop-2-enyl 2-oxopropanoate has a molecular weight of 129.12 g/mol, XLogP of 0.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (113C)prop-2-enyl 2-oxopropanoate is sourced from PubChem (CID 175750558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).