C22H13NO3 — CID 175751034
4-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]deca-1(9),2(6),7-triene-3,5,10-trione (PubChem CID 175751034) has the molecular formula C22H13NO3 and a molecular weight of 339.35 g/mol. Its IUPAC name is 4-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]deca-1(9),2(6),7-triene-3,5,10-trione.
| Compound Name | 4-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]deca-1(9),2(6),7-triene-3,5,10-trione |
|---|---|
| PubChem CID | 175751034 |
| Molecular Formula | C22H13NO3 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 4-methyl-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]deca-1(9),2(6),7-triene-3,5,10-trione |
| SMILES | Cn1c(=O)c2c3c(=O)c(c=2c1=O)=C(c1ccccc1)C=3c1ccccc1 |
| InChI | InChI=1S/C22H13NO3/c1-23-21(25)18-16-14(12-8-4-2-5-9-12)15(13-10-6-3-7-11-13)17(20(16)24)19(18)22(23)26/h2-11H,1H3 |
| InChIKey | JOUVGLBZKYGNBW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |