C16H16ClNO2 — CID 175751671
2-methoxy-4,9-dimethyl-5H-phenanthridin-6-one;hydrochloride (PubChem CID 175751671) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 2-methoxy-4,9-dimethyl-5H-phenanthridin-6-one;hydrochloride.
| Compound Name | 2-methoxy-4,9-dimethyl-5H-phenanthridin-6-one;hydrochloride |
|---|---|
| PubChem CID | 175751671 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-methoxy-4,9-dimethyl-5H-phenanthridin-6-one;hydrochloride |
| SMILES | COc1cc(C)c2[nH]c(=O)c3ccc(C)cc3c2c1.Cl |
| InChI | InChI=1S/C16H15NO2.ClH/c1-9-4-5-12-13(6-9)14-8-11(19-3)7-10(2)15(14)17-16(12)18;/h4-8H,1-3H3,(H,17,18);1H |
| InChIKey | OVELLXDQEVGZHO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|