C7H8BrNS — CID 175752095
2-bromo-2,4,5,6-tetrahydro-1,3-benzothiazole (PubChem CID 175752095) has the molecular formula C7H8BrNS and a molecular weight of 218.12 g/mol. Its IUPAC name is 2-bromo-2,4,5,6-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-bromo-2,4,5,6-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 175752095 |
| Molecular Formula | C7H8BrNS |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | 2-bromo-2,4,5,6-tetrahydro-1,3-benzothiazole |
| SMILES | BrC1N=C2CCCC=C2S1 |
| InChI | InChI=1S/C7H8BrNS/c8-7-9-5-3-1-2-4-6(5)10-7/h4,7H,1-3H2 |
| InChIKey | JVCLUNNIQVGBKQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|