C19H22O4 — CID 175752811
3,5,6,8-tetramethyl-2-phenyl-2,4-dihydrochromene-3,4,7-triol (PubChem CID 175752811) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3,5,6,8-tetramethyl-2-phenyl-2,4-dihydrochromene-3,4,7-triol.
| Compound Name | 3,5,6,8-tetramethyl-2-phenyl-2,4-dihydrochromene-3,4,7-triol |
|---|---|
| PubChem CID | 175752811 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3,5,6,8-tetramethyl-2-phenyl-2,4-dihydrochromene-3,4,7-triol |
| SMILES | Cc1c(C)c2c(c(C)c1O)OC(c1ccccc1)C(C)(O)C2O |
| InChI | InChI=1S/C19H22O4/c1-10-11(2)15(20)12(3)16-14(10)17(21)19(4,22)18(23-16)13-8-6-5-7-9-13/h5-9,17-18,20-22H,1-4H3 |
| InChIKey | KZJYCMPDHPKJTO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |