C18H20KN4O3S — CID 175753214
CID 175753214 (PubChem CID 175753214) has the molecular formula C18H20KN4O3S and a molecular weight of 411.55 g/mol.
| Compound Name | CID 175753214 |
|---|---|
| PubChem CID | 175753214 |
| Molecular Formula | C18H20KN4O3S |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | — |
| SMILES | Cc1nccnc1S(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.[K] |
| InChI | InChI=1S/C18H20N4O3S.K/c1-11-17(20-9-8-19-11)26(24,25)22-18(23)21-16-14-6-2-4-12(14)10-13-5-3-7-15(13)16;/h8-10H,2-7H2,1H3,(H2,21,22,23); |
| InChIKey | SRVXWNAPZOJVJE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |