C42H48BF3N6O6 — CID 175753515
tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]carbamate;tert-butyl N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]carbamate (PubChem CID 175753515) has the molecular formula C42H48BF3N6O6 and a molecular weight of 800.69 g/mol. Its IUPAC name is tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]carbamate;tert-butyl N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]carbamate;tert-butyl N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]carbamate |
|---|---|
| PubChem CID | 175753515 |
| Molecular Formula | C42H48BF3N6O6 |
| Molecular Weight | 800.69 g/mol |
| Exact Mass | 800.37 |
| IUPAC Name | tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]carbamate;tert-butyl N-[5-[1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]-1H-indol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c[nH]c2ccc(-c3cnn(-c4ccc(C(F)(F)F)cc4)c3)cc12.CC(C)(C)OC(=O)Nc1c[nH]c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C23H21F3N4O2.C19H27BN2O4/c1-22(2,3)32-21(31)29-20-12-27-19-9-4-14(10-18(19)20)15-11-28-30(13-15)17-7-5-16(6-8-17)23(24,25)26;1-17(2,3)24-16(23)22-15-11-21-14-9-8-12(10-13(14)15)20-25-18(4,5)19(6,7)26-20/h4-13,27H,1-3H3,(H,29,31);8-11,21H,1-7H3,(H,22,23) |
| InChIKey | DRGJHNRKSCAILG-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.69 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|