C16H16F2N2 — CID 175754439
4-(1,3-difluoronaphthalen-2-yl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole (PubChem CID 175754439) has the molecular formula C16H16F2N2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 4-(1,3-difluoronaphthalen-2-yl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4-(1,3-difluoronaphthalen-2-yl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 175754439 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-(1,3-difluoronaphthalen-2-yl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cc2ccccc2c(F)c1C1NCC2CNCC21 |
| InChI | InChI=1S/C16H16F2N2/c17-13-5-9-3-1-2-4-11(9)15(18)14(13)16-12-8-19-6-10(12)7-20-16/h1-5,10,12,16,19-20H,6-8H2 |
| InChIKey | KEFWJSVCGFFGMU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |