C26H25F2N5O5 — CID 175754641
2-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 175754641) has the molecular formula C26H25F2N5O5 and a molecular weight of 525.51 g/mol. Its IUPAC name is 2-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 2-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 175754641 |
| Molecular Formula | C26H25F2N5O5 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]pyrimidin-2-yl]-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COc1cc(OC)c(F)c(C#Cc2cnc(C3CCc4ccc(C(OC)OC)nc4N3C(N)=O)nc2)c1F |
| InChI | InChI=1S/C26H25F2N5O5/c1-35-19-11-20(36-2)22(28)16(21(19)27)8-5-14-12-30-23(31-13-14)18-10-7-15-6-9-17(25(37-3)38-4)32-24(15)33(18)26(29)34/h6,9,11-13,18,25H,7,10H2,1-4H3,(H2,29,34) |
| InChIKey | DQTYYFLJNFELKM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|