C17H14N4O — CID 175755127
[4-(4-amino-3H-imidazo[4,5-c]quinolin-7-yl)phenyl]methanol (PubChem CID 175755127) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is [4-(4-amino-3H-imidazo[4,5-c]quinolin-7-yl)phenyl]methanol.
| Compound Name | [4-(4-amino-3H-imidazo[4,5-c]quinolin-7-yl)phenyl]methanol |
|---|---|
| PubChem CID | 175755127 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [4-(4-amino-3H-imidazo[4,5-c]quinolin-7-yl)phenyl]methanol |
| SMILES | Nc1nc2cc(-c3ccc(CO)cc3)ccc2c2nc[nH]c12 |
| InChI | InChI=1S/C17H14N4O/c18-17-16-15(19-9-20-16)13-6-5-12(7-14(13)21-17)11-3-1-10(8-22)2-4-11/h1-7,9,22H,8H2,(H2,18,21)(H,19,20) |
| InChIKey | ZSNBBNIBESIUMQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |