C14H28O3Sn — CID 175755188
[(E)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane (PubChem CID 175755188) has the molecular formula C14H28O3Sn and a molecular weight of 363.09 g/mol. Its IUPAC name is [(E)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane.
| Compound Name | [(E)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane |
|---|---|
| PubChem CID | 175755188 |
| Molecular Formula | C14H28O3Sn |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [(E)-4-methoxy-4-[(2S,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-3-methylbut-1-enyl]stannane |
| SMILES | CC[C@H](OC)[C@@H](C)[C@H]1O[C@@H]1C(OC)C(C)/C=C/[SnH3] |
| InChI | InChI=1S/C14H25O3.Sn.3H/c1-7-9(3)12(16-6)14-13(17-14)10(4)11(8-2)15-5;;;;/h1,7,9-14H,8H2,2-6H3;;;;/t9?,10-,11+,12?,13-,14-;;;;/m1..../s1 |
| InChIKey | LXPNJNNOIOHVOV-XUVYAFQVSA-N |
| XLogP | 1.35 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|