About ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate
ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate (PubChem CID 175755381) has the molecular formula C14H17FN2O4
and a molecular weight of 296.30 g/mol. Its IUPAC name is ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate |
| PubChem CID | 175755381 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(F)c2ncn(CC(O)CCO)c2c1 |
| InChI | InChI=1S/C14H17FN2O4/c1-2-21-14(20)9-5-11(15)13-12(6-9)17(8-16-13)7-10(19)3-4-18/h5-6,8,10,18-19H,2-4,7H2,1H3 |
| InChIKey | FLAZGGLPESGZSQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate?
The IUPAC name of ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate (CID 175755381) is ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate?
The canonical SMILES for ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate is CCOC(=O)c1cc(F)c2ncn(CC(O)CCO)c2c1.
What is the InChIKey of ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate?
The InChIKey is FLAZGGLPESGZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN2O4/c1-2-21-14(20)9-5-11(15)13-12(6-9)17(8-16-13)7-10(19)3-4-18/h5-6,8,10,18-19H,2-4,7H2,1H3.
What are the key properties of ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate?
ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate has a molecular weight of 296.30 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(2,4-dihydroxybutyl)-7-fluorobenzimidazole-5-carboxylate is sourced from PubChem (CID 175755381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).