C36H42N4O5 — CID 175755587
ethyl 7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 175755587) has the molecular formula C36H42N4O5 and a molecular weight of 610.76 g/mol. Its IUPAC name is ethyl 7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 175755587 |
| Molecular Formula | C36H42N4O5 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | ethyl 7-[3-[(1R)-1-hydroxy-3-morpholin-4-ylpropyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c([C@H](O)CCN4CCOCC4)nn(C)c3C)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C36H42N4O5/c1-4-44-36(42)34-28(15-9-21-45-31-16-7-11-25-10-5-6-12-26(25)31)27-13-8-14-29(33(27)37-34)32-24(2)39(3)38-35(32)30(41)17-18-40-19-22-43-23-20-40/h5-8,10-14,16,30,37,41H,4,9,15,17-23H2,1-3H3/t30-/m1/s1 |
| InChIKey | LITBSTHKSHEZSR-SSEXGKCCSA-N |
| XLogP | 5.97 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|