About 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine
1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine (PubChem CID 175756672) has the molecular formula C12H19FN2
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine |
| PubChem CID | 175756672 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine |
| SMILES | FCCN1CCN(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H19FN2/c13-6-7-14-8-10-15(11-9-14)12-4-2-1-3-5-12/h2,4-5H,1,3,6-11H2 |
| InChIKey | GRMVDQMEGVBMJK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine (CID 175756672) is 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine is FCCN1CCN(C2=CCCC=C2)CC1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine?
The InChIKey is GRMVDQMEGVBMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN2/c13-6-7-14-8-10-15(11-9-14)12-4-2-1-3-5-12/h2,4-5H,1,3,6-11H2.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine?
1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine has a molecular weight of 210.30 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-4-(2-fluoroethyl)piperazine is sourced from PubChem (CID 175756672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).