About 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine
4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 175756689) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 175756689 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | COC1=CC(C2=CCN(C)CC2)=CCC1 |
| InChI | InChI=1S/C13H19NO/c1-14-8-6-11(7-9-14)12-4-3-5-13(10-12)15-2/h4,6,10H,3,5,7-9H2,1-2H3 |
| InChIKey | ULLGLVVUXFRCTO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine (CID 175756689) is 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine is COC1=CC(C2=CCN(C)CC2)=CCC1.
What is the InChIKey of 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is ULLGLVVUXFRCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-14-8-6-11(7-9-14)12-4-3-5-13(10-12)15-2/h4,6,10H,3,5,7-9H2,1-2H3.
What are the key properties of 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine?
4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 205.30 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methoxycyclohexa-1,5-dien-1-yl)-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 175756689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).