C19H12F6N4O — CID 175756831
1-[5-fluoro-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile (PubChem CID 175756831) has the molecular formula C19H12F6N4O and a molecular weight of 426.32 g/mol. Its IUPAC name is 1-[5-fluoro-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[5-fluoro-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 175756831 |
| Molecular Formula | C19H12F6N4O |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[5-fluoro-1-oxido-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2cc(F)c(-c3cc4ccn(CC(F)(F)C(F)(F)F)c4cn3)[n+]([O-])c2)CC1 |
| InChI | InChI=1S/C19H12F6N4O/c20-13-6-12(17(9-26)2-3-17)8-29(30)16(13)14-5-11-1-4-28(15(11)7-27-14)10-18(21,22)19(23,24)25/h1,4-8H,2-3,10H2 |
| InChIKey | ULQUPXMIOCSIEE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|