C24H29N3O5Si — CID 175757041
2-[(11R,15S)-4-(2-trimethylsilylethoxymethyl)-13,16-dioxa-2,4,10-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),2,5,7-tetraen-10-yl]benzoic acid (PubChem CID 175757041) has the molecular formula C24H29N3O5Si and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[(11R,15S)-4-(2-trimethylsilylethoxymethyl)-13,16-dioxa-2,4,10-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),2,5,7-tetraen-10-yl]benzoic acid.
| Compound Name | 2-[(11R,15S)-4-(2-trimethylsilylethoxymethyl)-13,16-dioxa-2,4,10-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),2,5,7-tetraen-10-yl]benzoic acid |
|---|---|
| PubChem CID | 175757041 |
| Molecular Formula | C24H29N3O5Si |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[(11R,15S)-4-(2-trimethylsilylethoxymethyl)-13,16-dioxa-2,4,10-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),2,5,7-tetraen-10-yl]benzoic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc3c(nc21)O[C@@H]1COC[C@H]1N3c1ccccc1C(=O)O |
| InChI | InChI=1S/C24H29N3O5Si/c1-33(2,3)11-10-30-15-26-9-8-16-12-19-23(25-22(16)26)32-21-14-31-13-20(21)27(19)18-7-5-4-6-17(18)24(28)29/h4-9,12,20-21H,10-11,13-15H2,1-3H3,(H,28,29)/t20-,21-/m1/s1 |
| InChIKey | IEDYVMMSOURCBP-NHCUHLMSSA-N |
| XLogP | 4.34 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|