C56H58ClF4N7O6S — CID 175758474
CID 175758474 (PubChem CID 175758474) has the molecular formula C56H58ClF4N7O6S and a molecular weight of 1068.63 g/mol.
| Compound Name | CID 175758474 |
|---|---|
| PubChem CID | 175758474 |
| Molecular Formula | C56H58ClF4N7O6S |
| Molecular Weight | 1068.63 g/mol |
| Exact Mass | 1067.38 |
| IUPAC Name | — |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2N[C@]3(CCCC(C)(C)C3)[C@@]3(CNc4cc(C(F)(F)F)ncc43)[C@H]2c2cccc(Cl)c2F)c2ccc(S(=O)(=O)N3CCC4(CC3)C[C@H]4C#Cc3cccc4c3CN([C@H]3CCC(=O)NC3=O)C4)cc2O1 |
| InChI | InChI=1S/C56H58ClF4N7O6S/c1-32-27-68(51(71)49-47(37-9-5-10-40(57)48(37)58)55(54(65-49)18-6-17-52(2,3)30-54)31-63-41-24-45(56(59,60)61)62-26-39(41)55)42-14-13-36(23-44(42)74-32)75(72,73)67-21-19-53(20-22-67)25-35(53)12-11-33-7-4-8-34-28-66(29-38(33)34)43-15-16-46(69)64-50(43)70/h4-5,7-10,13-14,23-24,26,32,35,43,47,49,63,65H,6,15-22,25,27-31H2,1-3H3,(H,64,69,70)/t32-,35-,43+,47+,49-,54+,55-/m1/s1 |
| InChIKey | BDZSDZUTVPEXFI-PTVFJNADSA-N |
| XLogP | 8.43 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1068.63 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|