About [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium
[[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175758699) has the molecular formula C14H20BrF2NOS
and a molecular weight of 368.29 g/mol. Its IUPAC name is [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium.
Molecular Properties
| Compound Name | [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium |
| PubChem CID | 175758699 |
| Molecular Formula | C14H20BrF2NOS |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | C[C@@H](N[S+]([O-])C(C)(C)C)c1cc(Br)cc(C(C)(F)F)c1 |
| InChI | InChI=1S/C14H20BrF2NOS/c1-9(18-20(19)13(2,3)4)10-6-11(14(5,16)17)8-12(15)7-10/h6-9,18H,1-5H3/t9-,20?/m1/s1 |
| InChIKey | MUISSJLRKQQOMP-VCLORWJBSA-N |
| XLogP | 4.67 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium?
The IUPAC name of [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium (CID 175758699) is [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium.
What is the SMILES notation for [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium?
The canonical SMILES for [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium is C[C@@H](N[S+]([O-])C(C)(C)C)c1cc(Br)cc(C(C)(F)F)c1.
What is the InChIKey of [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium?
The InChIKey is MUISSJLRKQQOMP-VCLORWJBSA-N. The full InChI is InChI=1S/C14H20BrF2NOS/c1-9(18-20(19)13(2,3)4)10-6-11(14(5,16)17)8-12(15)7-10/h6-9,18H,1-5H3/t9-,20?/m1/s1.
What are the key properties of [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium?
[[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium has a molecular weight of 368.29 g/mol, XLogP of 4.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1R)-1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium is sourced from PubChem (CID 175758699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).