C82H96F6N10Os+2 — CID 175758971
bis(4-tert-butyl-2-[1,2,5-tris(4-tert-butyl-2-pyridinyl)-4-(trifluoromethyl)pyrrol-3-yl]pyridine);osmium(2+) (PubChem CID 175758971) has the molecular formula C82H96F6N10Os+2 and a molecular weight of 1525.96 g/mol. Its IUPAC name is bis(4-tert-butyl-2-[1,2,5-tris(4-tert-butyl-2-pyridinyl)-4-(trifluoromethyl)pyrrol-3-yl]pyridine);osmium(2+).
| Compound Name | bis(4-tert-butyl-2-[1,2,5-tris(4-tert-butyl-2-pyridinyl)-4-(trifluoromethyl)pyrrol-3-yl]pyridine);osmium(2+) |
|---|---|
| PubChem CID | 175758971 |
| Molecular Formula | C82H96F6N10Os+2 |
| Molecular Weight | 1525.96 g/mol |
| Exact Mass | 1526.73 |
| IUPAC Name | bis(4-tert-butyl-2-[1,2,5-tris(4-tert-butyl-2-pyridinyl)-4-(trifluoromethyl)pyrrol-3-yl]pyridine);osmium(2+) |
| SMILES | CC(C)(C)c1ccnc(-c2c(C(F)(F)F)c(-c3cc(C(C)(C)C)ccn3)n(-c3cc(C(C)(C)C)ccn3)c2-c2cc(C(C)(C)C)ccn2)c1.CC(C)(C)c1ccnc(-c2c(C(F)(F)F)c(-c3cc(C(C)(C)C)ccn3)n(-c3cc(C(C)(C)C)ccn3)c2-c2cc(C(C)(C)C)ccn2)c1.[Os+2] |
| InChI | InChI=1S/2C41H48F3N5.Os/c2*1-37(2,3)25-13-17-45-29(21-25)33-34(41(42,43)44)36(31-23-27(15-19-47-31)39(7,8)9)49(32-24-28(16-20-48-32)40(10,11)12)35(33)30-22-26(14-18-46-30)38(4,5)6;/h2*13-24H,1-12H3;/q;;+2 |
| InChIKey | PZMZBHSRIASGOH-UHFFFAOYSA-N |
| XLogP | 22.53 |
| TPSA | 112.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1525.96 |
| LogP ≤ 5 | 22.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |