C20H23N3O — CID 175759178
1-[5-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-methyl-4-phenyl-1H-pyrrol-3-yl]ethanone (PubChem CID 175759178) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[5-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-methyl-4-phenyl-1H-pyrrol-3-yl]ethanone.
| Compound Name | 1-[5-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-methyl-4-phenyl-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 175759178 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-[5-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-2-methyl-4-phenyl-1H-pyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)[nH]c(C2=NC3CCCCC3N2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H23N3O/c1-12-17(13(2)24)18(14-8-4-3-5-9-14)19(21-12)20-22-15-10-6-7-11-16(15)23-20/h3-5,8-9,15-16,21H,6-7,10-11H2,1-2H3,(H,22,23) |
| InChIKey | OIHPPAAOIVPOOY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |