C13H7F8N5O — CID 175759372
6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]-7-(trifluoromethyl)-8H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 175759372) has the molecular formula C13H7F8N5O and a molecular weight of 401.22 g/mol. Its IUPAC name is 6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]-7-(trifluoromethyl)-8H-imidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]-7-(trifluoromethyl)-8H-imidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 175759372 |
| Molecular Formula | C13H7F8N5O |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 6-[1-(2,2,3,3,3-pentafluoropropyl)pyrazol-4-yl]-7-(trifluoromethyl)-8H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | O=c1c(-c2cnn(CC(F)(F)C(F)(F)F)c2)c(C(F)(F)F)[nH]c2nccn12 |
| InChI | InChI=1S/C13H7F8N5O/c14-11(15,13(19,20)21)5-25-4-6(3-23-25)7-8(12(16,17)18)24-10-22-1-2-26(10)9(7)27/h1-4H,5H2,(H,22,24) |
| InChIKey | GTHCBHBXKQJEAI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|