C12H14Cl2N4O2 — CID 175759715
(3R,6S)-6-[5-(6-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]oxan-3-amine;hydrochloride (PubChem CID 175759715) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is (3R,6S)-6-[5-(6-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]oxan-3-amine;hydrochloride.
| Compound Name | (3R,6S)-6-[5-(6-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]oxan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 175759715 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (3R,6S)-6-[5-(6-chloro-3-pyridinyl)-1,3,4-oxadiazol-2-yl]oxan-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CC[C@@H](c2nnc(-c3ccc(Cl)nc3)o2)OC1 |
| InChI | InChI=1S/C12H13ClN4O2.ClH/c13-10-4-1-7(5-15-10)11-16-17-12(19-11)9-3-2-8(14)6-18-9;/h1,4-5,8-9H,2-3,6,14H2;1H/t8-,9+;/m1./s1 |
| InChIKey | AJOHGKCMHPGBJJ-RJUBDTSPSA-N |
| XLogP | 2.39 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|