C10H15F5O — CID 175759768
1-(1,2,3,3,3-pentafluoroprop-1-enoxy)heptane (PubChem CID 175759768) has the molecular formula C10H15F5O and a molecular weight of 246.22 g/mol. Its IUPAC name is 1-(1,2,3,3,3-pentafluoroprop-1-enoxy)heptane.
| Compound Name | 1-(1,2,3,3,3-pentafluoroprop-1-enoxy)heptane |
|---|---|
| PubChem CID | 175759768 |
| Molecular Formula | C10H15F5O |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(1,2,3,3,3-pentafluoroprop-1-enoxy)heptane |
| SMILES | CCCCCCCOC(F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F5O/c1-2-3-4-5-6-7-16-9(12)8(11)10(13,14)15/h2-7H2,1H3 |
| InChIKey | YQUHJMKPIZMRQM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|