About cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one
cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one (PubChem CID 175759796) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one.
Molecular Properties
| Compound Name | cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one |
| PubChem CID | 175759796 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one |
| SMILES | O=C1CCCCCCCCCC[C@H](O)[C@H](O)CCO1 |
| InChI | InChI=1S/C15H28O4/c16-13-9-7-5-3-1-2-4-6-8-10-15(18)19-12-11-14(13)17/h13-14,16-17H,1-12H2/t13-,14+/m0/s1 |
| InChIKey | FOEYHUNDVPCXBT-UONOGXRCSA-N |
| XLogP | 2.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one?
The IUPAC name of cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one (CID 175759796) is cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one.
What is the SMILES notation for cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one?
The canonical SMILES for cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one is O=C1CCCCCCCCCC[C@H](O)[C@H](O)CCO1.
What is the InChIKey of cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one?
The InChIKey is FOEYHUNDVPCXBT-UONOGXRCSA-N. The full InChI is InChI=1S/C15H28O4/c16-13-9-7-5-3-1-2-4-6-8-10-15(18)19-12-11-14(13)17/h13-14,16-17H,1-12H2/t13-,14+/m0/s1.
What are the key properties of cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one?
cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one has a molecular weight of 272.38 g/mol, XLogP of 2.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(13S,14R)-13,14-dihydroxy-oxacyclohexadecan-2-one is sourced from PubChem (CID 175759796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).