About 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide
2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide (PubChem CID 175760531) has the molecular formula C20H19Cl2F2N3O2S
and a molecular weight of 474.36 g/mol. Its IUPAC name is 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide |
| PubChem CID | 175760531 |
| Molecular Formula | C20H19Cl2F2N3O2S |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(F)(F)C2CCNCC2)cc1-c1ccc(Cl)c2c(Cl)c[nH]c12 |
| InChI | InChI=1S/C20H19Cl2F2N3O2S/c21-15-3-2-13(19-18(15)16(22)10-27-19)14-9-12(1-4-17(14)30(25,28)29)20(23,24)11-5-7-26-8-6-11/h1-4,9-11,26-27H,5-8H2,(H2,25,28,29) |
| InChIKey | XCHXATWIOMBDPE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide?
The IUPAC name of 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide (CID 175760531) is 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide?
The canonical SMILES for 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide is NS(=O)(=O)c1ccc(C(F)(F)C2CCNCC2)cc1-c1ccc(Cl)c2c(Cl)c[nH]c12.
What is the InChIKey of 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide?
The InChIKey is XCHXATWIOMBDPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2F2N3O2S/c21-15-3-2-13(19-18(15)16(22)10-27-19)14-9-12(1-4-17(14)30(25,28)29)20(23,24)11-5-7-26-8-6-11/h1-4,9-11,26-27H,5-8H2,(H2,25,28,29).
What are the key properties of 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide?
2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide has a molecular weight of 474.36 g/mol, XLogP of 4.88, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichloro-1H-indol-7-yl)-4-[difluoro(piperidin-4-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 175760531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).