C14H15N3O2S — CID 175760654
3-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 175760654) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 3-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 175760654 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-propan-2-yl-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | CC(C)N1C(=O)C(Cc2c[nH]c3ncccc23)OC1=S |
| InChI | InChI=1S/C14H15N3O2S/c1-8(2)17-13(18)11(19-14(17)20)6-9-7-16-12-10(9)4-3-5-15-12/h3-5,7-8,11H,6H2,1-2H3,(H,15,16) |
| InChIKey | CONAUPQHEYHHSP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|