About lithium;difluorophosphinate;tris(trimethylsilyl) phosphate
lithium;difluorophosphinate;tris(trimethylsilyl) phosphate (PubChem CID 175760786) has the molecular formula C9H27F2LiO6P2Si3
and a molecular weight of 422.45 g/mol. Its IUPAC name is lithium;difluorophosphinate;tris(trimethylsilyl) phosphate.
Molecular Properties
| Compound Name | lithium;difluorophosphinate;tris(trimethylsilyl) phosphate |
| PubChem CID | 175760786 |
| Molecular Formula | C9H27F2LiO6P2Si3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | lithium;difluorophosphinate;tris(trimethylsilyl) phosphate |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C.O=P([O-])(F)F.[Li+] |
| InChI | InChI=1S/C9H27O4PSi3.F2HO2P.Li/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9;1-5(2,3)4;/h1-9H3;(H,3,4);/q;;+1/p-1 |
| InChIKey | XRCYGCFNWUROKX-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;difluorophosphinate;tris(trimethylsilyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;difluorophosphinate;tris(trimethylsilyl) phosphate?
The IUPAC name of lithium;difluorophosphinate;tris(trimethylsilyl) phosphate (CID 175760786) is lithium;difluorophosphinate;tris(trimethylsilyl) phosphate.
What is the SMILES notation for lithium;difluorophosphinate;tris(trimethylsilyl) phosphate?
The canonical SMILES for lithium;difluorophosphinate;tris(trimethylsilyl) phosphate is C[Si](C)(C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C.O=P([O-])(F)F.[Li+].
What is the InChIKey of lithium;difluorophosphinate;tris(trimethylsilyl) phosphate?
The InChIKey is XRCYGCFNWUROKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H27O4PSi3.F2HO2P.Li/c1-15(2,3)11-14(10,12-16(4,5)6)13-17(7,8)9;1-5(2,3)4;/h1-9H3;(H,3,4);/q;;+1/p-1.
What are the key properties of lithium;difluorophosphinate;tris(trimethylsilyl) phosphate?
lithium;difluorophosphinate;tris(trimethylsilyl) phosphate has a molecular weight of 422.45 g/mol, XLogP of 2.05, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;difluorophosphinate;tris(trimethylsilyl) phosphate is sourced from PubChem (CID 175760786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).