C20H20F3N5O3 — CID 175761050
4,5-bis(hydroxymethyl)-2-methyl-1-[3-[2-(trifluoromethyl)phenyl]-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-2H-pyridin-3-ol (PubChem CID 175761050) has the molecular formula C20H20F3N5O3 and a molecular weight of 435.41 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methyl-1-[3-[2-(trifluoromethyl)phenyl]-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-2H-pyridin-3-ol.
| Compound Name | 4,5-bis(hydroxymethyl)-2-methyl-1-[3-[2-(trifluoromethyl)phenyl]-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 175761050 |
| Molecular Formula | C20H20F3N5O3 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methyl-1-[3-[2-(trifluoromethyl)phenyl]-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-2H-pyridin-3-ol |
| SMILES | CC1C(O)=C(CO)C(CO)=CN1C1=Nn2c(nnc2-c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H20F3N5O3/c1-11-18(31)14(10-30)12(9-29)8-27(11)17-7-6-16-24-25-19(28(16)26-17)13-4-2-3-5-15(13)20(21,22)23/h2-5,8,11,29-31H,6-7,9-10H2,1H3 |
| InChIKey | SLNMDYMZWPFBBI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |