About trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane
trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane (PubChem CID 175761676) has the molecular formula C7H14N4O2Si
and a molecular weight of 214.30 g/mol. Its IUPAC name is trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane |
| PubChem CID | 175761676 |
| Molecular Formula | C7H14N4O2Si |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane |
| SMILES | C[Si](C)(C)CCn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C7H14N4O2Si/c1-14(2,3)5-4-10-6-8-7(9-10)11(12)13/h6H,4-5H2,1-3H3 |
| InChIKey | NFVFILBPVDRPLD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane?
The IUPAC name of trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane (CID 175761676) is trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane.
What is the SMILES notation for trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane?
The canonical SMILES for trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane is C[Si](C)(C)CCn1cnc([N+](=O)[O-])n1.
What is the InChIKey of trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane?
The InChIKey is NFVFILBPVDRPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O2Si/c1-14(2,3)5-4-10-6-8-7(9-10)11(12)13/h6H,4-5H2,1-3H3.
What are the key properties of trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane?
trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane has a molecular weight of 214.30 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-(3-nitro-1,2,4-triazol-1-yl)ethyl]silane is sourced from PubChem (CID 175761676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).