C20H14BrN3O2 — CID 175762051
7,9-bis(4-aminophenyl)-6-bromo-3-azabicyclo[3.3.1]nona-1(9),5,7-triene-2,4-dione (PubChem CID 175762051) has the molecular formula C20H14BrN3O2 and a molecular weight of 408.26 g/mol. Its IUPAC name is 7,9-bis(4-aminophenyl)-6-bromo-3-azabicyclo[3.3.1]nona-1(9),5,7-triene-2,4-dione.
| Compound Name | 7,9-bis(4-aminophenyl)-6-bromo-3-azabicyclo[3.3.1]nona-1(9),5,7-triene-2,4-dione |
|---|---|
| PubChem CID | 175762051 |
| Molecular Formula | C20H14BrN3O2 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 7,9-bis(4-aminophenyl)-6-bromo-3-azabicyclo[3.3.1]nona-1(9),5,7-triene-2,4-dione |
| SMILES | Nc1ccc(-c2cc3c(-c4ccc(N)cc4)c(c2Br)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C20H14BrN3O2/c21-18-14(10-1-5-12(22)6-2-10)9-15-16(11-3-7-13(23)8-4-11)17(18)20(26)24-19(15)25/h1-9H,22-23H2,(H,24,25,26) |
| InChIKey | HDICRAQPUQSDPH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|