C23H32O4 — CID 175763233
[5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxo-2-pentylcyclohexa-1,4-dien-1-yl] acetate (PubChem CID 175763233) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxo-2-pentylcyclohexa-1,4-dien-1-yl] acetate.
| Compound Name | [5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxo-2-pentylcyclohexa-1,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 175763233 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [5-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dioxo-2-pentylcyclohexa-1,4-dien-1-yl] acetate |
| SMILES | CCCCCC1=C(OC(C)=O)C(=O)C(C/C=C(\C)CCC=C(C)C)=CC1=O |
| InChI | InChI=1S/C23H32O4/c1-6-7-8-12-20-21(25)15-19(22(26)23(20)27-18(5)24)14-13-17(4)11-9-10-16(2)3/h10,13,15H,6-9,11-12,14H2,1-5H3/b17-13+ |
| InChIKey | PUAIWIDNIUVAIC-GHRIWEEISA-N |
| XLogP | 5.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|