C15H14FN3O2 — CID 175763959
1-(cyclopropylmethyl)-5-(5-fluoro-2-pyridinyl)-4-oxopyridine-3-carboxamide (PubChem CID 175763959) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-5-(5-fluoro-2-pyridinyl)-4-oxopyridine-3-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-5-(5-fluoro-2-pyridinyl)-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 175763959 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-(cyclopropylmethyl)-5-(5-fluoro-2-pyridinyl)-4-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1cn(CC2CC2)cc(-c2ccc(F)cn2)c1=O |
| InChI | InChI=1S/C15H14FN3O2/c16-10-3-4-13(18-5-10)11-7-19(6-9-1-2-9)8-12(14(11)20)15(17)21/h3-5,7-9H,1-2,6H2,(H2,17,21) |
| InChIKey | ALCQKTLVKIYGET-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |