About (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone
(4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone (PubChem CID 175764250) has the molecular formula C18H15BrClNO2
and a molecular weight of 392.68 g/mol. Its IUPAC name is (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone.
Molecular Properties
| Compound Name | (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone |
| PubChem CID | 175764250 |
| Molecular Formula | C18H15BrClNO2 |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone |
| SMILES | CC1=NC(C)(c2ccc(Cl)cc2)C(C(=O)c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C18H15BrClNO2/c1-11-21-18(2,13-5-9-15(20)10-6-13)17(23-11)16(22)12-3-7-14(19)8-4-12/h3-10,17H,1-2H3 |
| InChIKey | SYQWCHVNVOCHST-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone?
The IUPAC name of (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone (CID 175764250) is (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone.
What is the SMILES notation for (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone?
The canonical SMILES for (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone is CC1=NC(C)(c2ccc(Cl)cc2)C(C(=O)c2ccc(Br)cc2)O1.
What is the InChIKey of (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone?
The InChIKey is SYQWCHVNVOCHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrClNO2/c1-11-21-18(2,13-5-9-15(20)10-6-13)17(23-11)16(22)12-3-7-14(19)8-4-12/h3-10,17H,1-2H3.
What are the key properties of (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone?
(4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone has a molecular weight of 392.68 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-[4-(4-chlorophenyl)-2,4-dimethyl-5H-1,3-oxazol-5-yl]methanone is sourced from PubChem (CID 175764250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).