C10H10N4O — CID 175764708
12-deuterio-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene (PubChem CID 175764708) has the molecular formula C10H10N4O and a molecular weight of 203.22 g/mol. Its IUPAC name is 12-deuterio-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene.
| Compound Name | 12-deuterio-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
|---|---|
| PubChem CID | 175764708 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 12-deuterio-10-ethoxy-4,5,7,8-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,6,9,11-pentaene |
| SMILES | [2H]c1cc(OCC)cn2nc3[nH]ncc3c12 |
| InChI | InChI=1S/C10H10N4O/c1-2-15-7-3-4-9-8-5-11-12-10(8)13-14(9)6-7/h3-6H,2H2,1H3,(H,12,13)/i4D |
| InChIKey | JKXXQGYAOIQJLG-QYKNYGDISA-N |
| XLogP | 1.61 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |