C32H36N2O6 — CID 175766130
3-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(methoxymethyl)phenyl]indol-5-yl]-5-nitrophenyl]propanoic acid (PubChem CID 175766130) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is 3-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(methoxymethyl)phenyl]indol-5-yl]-5-nitrophenyl]propanoic acid.
| Compound Name | 3-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(methoxymethyl)phenyl]indol-5-yl]-5-nitrophenyl]propanoic acid |
|---|---|
| PubChem CID | 175766130 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 3-[3-[1-ethyl-3-(3-hydroxy-2,2-dimethylpropyl)-2-[2-(methoxymethyl)phenyl]indol-5-yl]-5-nitrophenyl]propanoic acid |
| SMILES | CCn1c(-c2ccccc2COC)c(CC(C)(C)CO)c2cc(-c3cc(CCC(=O)O)cc([N+](=O)[O-])c3)ccc21 |
| InChI | InChI=1S/C32H36N2O6/c1-5-33-29-12-11-22(24-14-21(10-13-30(36)37)15-25(16-24)34(38)39)17-27(29)28(18-32(2,3)20-35)31(33)26-9-7-6-8-23(26)19-40-4/h6-9,11-12,14-17,35H,5,10,13,18-20H2,1-4H3,(H,36,37) |
| InChIKey | LBDGEOWXZPZFJH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|