C29H34N6O8 — CID 175766297
(4S)-5-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 175766297) has the molecular formula C29H34N6O8 and a molecular weight of 594.63 g/mol. Its IUPAC name is (4S)-5-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (4S)-5-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 175766297 |
| Molecular Formula | C29H34N6O8 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | (4S)-5-[[(2S)-5-(diaminomethylideneamino)-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C29H34N6O8/c1-17-14-25(38)43-23-15-19(9-10-20(17)23)33-26(39)21(8-5-13-32-28(30)31)34-27(40)22(11-12-24(36)37)35-29(41)42-16-18-6-3-2-4-7-18/h2-4,6-7,9-10,14-15,21-22H,5,8,11-13,16H2,1H3,(H,33,39)(H,34,40)(H,35,41)(H,36,37)(H4,30,31,32)/t21-,22-/m0/s1 |
| InChIKey | UAWXGYMNNCZNLU-VXKWHMMOSA-N |
| XLogP | 1.74 |
| TPSA | 228.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|