About 3H-dithiole;nickel(2+);tetraethylazanium
3H-dithiole;nickel(2+);tetraethylazanium (PubChem CID 175766341) has the molecular formula C11H24NNiS2+3
and a molecular weight of 293.15 g/mol. Its IUPAC name is 3H-dithiole;nickel(2+);tetraethylazanium.
Molecular Properties
| Compound Name | 3H-dithiole;nickel(2+);tetraethylazanium |
| PubChem CID | 175766341 |
| Molecular Formula | C11H24NNiS2+3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3H-dithiole;nickel(2+);tetraethylazanium |
| SMILES | C1=CSSC1.CC[N+](CC)(CC)CC.[Ni+2] |
| InChI | InChI=1S/C8H20N.C3H4S2.Ni/c1-5-9(6-2,7-3)8-4;1-2-4-5-3-1;/h5-8H2,1-4H3;1-2H,3H2;/q+1;;+2 |
| InChIKey | VEJACWGCEKEPKA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3H-dithiole;nickel(2+);tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dithiole;nickel(2+);tetraethylazanium?
The IUPAC name of 3H-dithiole;nickel(2+);tetraethylazanium (CID 175766341) is 3H-dithiole;nickel(2+);tetraethylazanium.
What is the SMILES notation for 3H-dithiole;nickel(2+);tetraethylazanium?
The canonical SMILES for 3H-dithiole;nickel(2+);tetraethylazanium is C1=CSSC1.CC[N+](CC)(CC)CC.[Ni+2].
What is the InChIKey of 3H-dithiole;nickel(2+);tetraethylazanium?
The InChIKey is VEJACWGCEKEPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C3H4S2.Ni/c1-5-9(6-2,7-3)8-4;1-2-4-5-3-1;/h5-8H2,1-4H3;1-2H,3H2;/q+1;;+2.
What are the key properties of 3H-dithiole;nickel(2+);tetraethylazanium?
3H-dithiole;nickel(2+);tetraethylazanium has a molecular weight of 293.15 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dithiole;nickel(2+);tetraethylazanium is sourced from PubChem (CID 175766341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).