C24H27Cl2N3O2 — CID 175766906
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate (PubChem CID 175766906) has the molecular formula C24H27Cl2N3O2 and a molecular weight of 460.41 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate |
|---|---|
| PubChem CID | 175766906 |
| Molecular Formula | C24H27Cl2N3O2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] N-[5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl]carbamate |
| SMILES | CC1(C)Cc2cc(-c3cc(Cl)ncc3Cl)ccc2C1NC(=O)O[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C24H27Cl2N3O2/c1-24(2)11-16-9-15(18-10-21(26)27-12-19(18)25)3-4-17(16)22(24)28-23(30)31-20-13-29-7-5-14(20)6-8-29/h3-4,9-10,12,14,20,22H,5-8,11,13H2,1-2H3,(H,28,30)/t20-,22?/m0/s1 |
| InChIKey | JNDXPKBDYIEBTO-AIBWNMTMSA-N |
| XLogP | 5.50 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|