C26H23NO7 — CID 175767159
methyl (1R,9R,10S,11S)-1-hydroxy-5-methoxy-9-(4-methoxyphenyl)-12-oxo-10-phenyl-8-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylate (PubChem CID 175767159) has the molecular formula C26H23NO7 and a molecular weight of 461.47 g/mol. Its IUPAC name is methyl (1R,9R,10S,11S)-1-hydroxy-5-methoxy-9-(4-methoxyphenyl)-12-oxo-10-phenyl-8-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylate.
| Compound Name | methyl (1R,9R,10S,11S)-1-hydroxy-5-methoxy-9-(4-methoxyphenyl)-12-oxo-10-phenyl-8-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 175767159 |
| Molecular Formula | C26H23NO7 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | methyl (1R,9R,10S,11S)-1-hydroxy-5-methoxy-9-(4-methoxyphenyl)-12-oxo-10-phenyl-8-oxa-3-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-11-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccccc2)[C@]2(c3ccc(OC)cc3)Oc3cc(OC)cnc3[C@@]1(O)C2=O |
| InChI | InChI=1S/C26H23NO7/c1-31-17-11-9-16(10-12-17)26-20(15-7-5-4-6-8-15)21(23(28)33-3)25(30,24(26)29)22-19(34-26)13-18(32-2)14-27-22/h4-14,20-21,30H,1-3H3/t20-,21-,25-,26+/m1/s1 |
| InChIKey | SFDARLCINLUPFL-ZEZQGNGESA-N |
| XLogP | 2.73 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |