About 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 175767826) has the molecular formula C9H8N2OS
and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 175767826 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1ccnc2scc(C3CC3)n12 |
| InChI | InChI=1S/C9H8N2OS/c12-8-3-4-10-9-11(8)7(5-13-9)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | QCSITYRFTXLXBZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 175767826) is 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is O=c1ccnc2scc(C3CC3)n12.
What is the InChIKey of 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is QCSITYRFTXLXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS/c12-8-3-4-10-9-11(8)7(5-13-9)6-1-2-6/h3-6H,1-2H2.
What are the key properties of 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 192.24 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 175767826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).